C21H24N2O3 — CID 154880998
phenyl N-[4-[[1-(cyclopropylmethyl)aziridin-2-yl]methoxy]phenyl]-N-methylcarbamate (PubChem CID 154880998) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is phenyl N-[4-[[1-(cyclopropylmethyl)aziridin-2-yl]methoxy]phenyl]-N-methylcarbamate.
| Compound Name | phenyl N-[4-[[1-(cyclopropylmethyl)aziridin-2-yl]methoxy]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 154880998 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | phenyl N-[4-[[1-(cyclopropylmethyl)aziridin-2-yl]methoxy]phenyl]-N-methylcarbamate |
| SMILES | CN(C(=O)Oc1ccccc1)c1ccc(OCC2CN2CC2CC2)cc1 |
| InChI | InChI=1S/C21H24N2O3/c1-22(21(24)26-20-5-3-2-4-6-20)17-9-11-19(12-10-17)25-15-18-14-23(18)13-16-7-8-16/h2-6,9-12,16,18H,7-8,13-15H2,1H3 |
| InChIKey | NHXQWXQRFKEPDI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 41.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|