C21H25N5O — CID 154881006
7-[4-[[1-(cyclopropylmethyl)aziridin-2-yl]methoxy]phenyl]-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 154881006) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 7-[4-[[1-(cyclopropylmethyl)aziridin-2-yl]methoxy]phenyl]-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[4-[[1-(cyclopropylmethyl)aziridin-2-yl]methoxy]phenyl]-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 154881006 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 7-[4-[[1-(cyclopropylmethyl)aziridin-2-yl]methoxy]phenyl]-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1c(C)n(-c2ccc(OCC3CN3CC3CC3)cc2)c2ncnc(N)c12 |
| InChI | InChI=1S/C21H25N5O/c1-13-14(2)26(21-19(13)20(22)23-12-24-21)16-5-7-18(8-6-16)27-11-17-10-25(17)9-15-3-4-15/h5-8,12,15,17H,3-4,9-11H2,1-2H3,(H2,22,23,24) |
| InChIKey | GJEACJDUIMKCAI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 68.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|