C21H30N2O2 — CID 11188132
[3-[2-[methyl(prop-2-ynyl)amino]propyl]phenyl] N-cyclohexyl-N-methylcarbamate (PubChem CID 11188132) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is [3-[2-[methyl(prop-2-ynyl)amino]propyl]phenyl] N-cyclohexyl-N-methylcarbamate.
| Compound Name | [3-[2-[methyl(prop-2-ynyl)amino]propyl]phenyl] N-cyclohexyl-N-methylcarbamate |
|---|---|
| PubChem CID | 11188132 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | [3-[2-[methyl(prop-2-ynyl)amino]propyl]phenyl] N-cyclohexyl-N-methylcarbamate |
| SMILES | C#CCN(C)C(C)Cc1cccc(OC(=O)N(C)C2CCCCC2)c1 |
| InChI | InChI=1S/C21H30N2O2/c1-5-14-22(3)17(2)15-18-10-9-13-20(16-18)25-21(24)23(4)19-11-7-6-8-12-19/h1,9-10,13,16-17,19H,6-8,11-12,14-15H2,2-4H3 |
| InChIKey | FTMQGFFVKGHYEQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|