About pyridin-4-yl N-[(2R)-1-phenylpropan-2-yl]-N-prop-2-ynylcarbamate
pyridin-4-yl N-[(2R)-1-phenylpropan-2-yl]-N-prop-2-ynylcarbamate (PubChem CID 10756211) has the molecular formula C18H18N2O2
and a molecular weight of 294.35 g/mol. Its IUPAC name is pyridin-4-yl N-[(2R)-1-phenylpropan-2-yl]-N-prop-2-ynylcarbamate.
Molecular Properties
| Compound Name | pyridin-4-yl N-[(2R)-1-phenylpropan-2-yl]-N-prop-2-ynylcarbamate |
| PubChem CID | 10756211 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | pyridin-4-yl N-[(2R)-1-phenylpropan-2-yl]-N-prop-2-ynylcarbamate |
| SMILES | C#CCN(C(=O)Oc1ccncc1)[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C18H18N2O2/c1-3-13-20(15(2)14-16-7-5-4-6-8-16)18(21)22-17-9-11-19-12-10-17/h1,4-12,15H,13-14H2,2H3/t15-/m1/s1 |
| InChIKey | BXMYEJJPABSOGC-OAHLLOKOSA-N |
| XLogP | 3.15 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze pyridin-4-yl N-[(2R)-1-phenylpropan-2-yl]-N-prop-2-ynylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-4-yl N-[(2R)-1-phenylpropan-2-yl]-N-prop-2-ynylcarbamate?
The IUPAC name of pyridin-4-yl N-[(2R)-1-phenylpropan-2-yl]-N-prop-2-ynylcarbamate (CID 10756211) is pyridin-4-yl N-[(2R)-1-phenylpropan-2-yl]-N-prop-2-ynylcarbamate.
What is the SMILES notation for pyridin-4-yl N-[(2R)-1-phenylpropan-2-yl]-N-prop-2-ynylcarbamate?
The canonical SMILES for pyridin-4-yl N-[(2R)-1-phenylpropan-2-yl]-N-prop-2-ynylcarbamate is C#CCN(C(=O)Oc1ccncc1)[C@H](C)Cc1ccccc1.
What is the InChIKey of pyridin-4-yl N-[(2R)-1-phenylpropan-2-yl]-N-prop-2-ynylcarbamate?
The InChIKey is BXMYEJJPABSOGC-OAHLLOKOSA-N. The full InChI is InChI=1S/C18H18N2O2/c1-3-13-20(15(2)14-16-7-5-4-6-8-16)18(21)22-17-9-11-19-12-10-17/h1,4-12,15H,13-14H2,2H3/t15-/m1/s1.
What are the key properties of pyridin-4-yl N-[(2R)-1-phenylpropan-2-yl]-N-prop-2-ynylcarbamate?
pyridin-4-yl N-[(2R)-1-phenylpropan-2-yl]-N-prop-2-ynylcarbamate has a molecular weight of 294.35 g/mol, XLogP of 3.15, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-4-yl N-[(2R)-1-phenylpropan-2-yl]-N-prop-2-ynylcarbamate is sourced from PubChem (CID 10756211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).