C12H15NO2S — CID 175784116
[(2R)-2-[prop-2-ynyl(sulfino)amino]propyl]benzene (PubChem CID 175784116) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is [(2R)-2-[prop-2-ynyl(sulfino)amino]propyl]benzene.
| Compound Name | [(2R)-2-[prop-2-ynyl(sulfino)amino]propyl]benzene |
|---|---|
| PubChem CID | 175784116 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | [(2R)-2-[prop-2-ynyl(sulfino)amino]propyl]benzene |
| SMILES | C#CCN([C@H](C)Cc1ccccc1)S(=O)O |
| InChI | InChI=1S/C12H15NO2S/c1-3-9-13(16(14)15)11(2)10-12-7-5-4-6-8-12/h1,4-8,11H,9-10H2,2H3,(H,14,15)/t11-/m1/s1 |
| InChIKey | GRTFLKTVIGWDAW-LLVKDONJSA-N |
| XLogP | 1.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|