C20H28N2O2 — CID 11068527
[3-[2-(prop-2-ynylamino)propyl]phenyl] N-cyclohexyl-N-methylcarbamate (PubChem CID 11068527) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is [3-[2-(prop-2-ynylamino)propyl]phenyl] N-cyclohexyl-N-methylcarbamate.
| Compound Name | [3-[2-(prop-2-ynylamino)propyl]phenyl] N-cyclohexyl-N-methylcarbamate |
|---|---|
| PubChem CID | 11068527 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | [3-[2-(prop-2-ynylamino)propyl]phenyl] N-cyclohexyl-N-methylcarbamate |
| SMILES | C#CCNC(C)Cc1cccc(OC(=O)N(C)C2CCCCC2)c1 |
| InChI | InChI=1S/C20H28N2O2/c1-4-13-21-16(2)14-17-9-8-12-19(15-17)24-20(23)22(3)18-10-6-5-7-11-18/h1,8-9,12,15-16,18,21H,5-7,10-11,13-14H2,2-3H3 |
| InChIKey | SHYBFEOFEFSCKU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|