C12H14N2O7S — CID 59735294
[(5S)-3-ethyl-2-oxo-1,3-oxazolidin-5-yl]methyl 4-nitrobenzenesulfonate (PubChem CID 59735294) has the molecular formula C12H14N2O7S and a molecular weight of 330.32 g/mol. Its IUPAC name is [(5S)-3-ethyl-2-oxo-1,3-oxazolidin-5-yl]methyl 4-nitrobenzenesulfonate.
| Compound Name | [(5S)-3-ethyl-2-oxo-1,3-oxazolidin-5-yl]methyl 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 59735294 |
| Molecular Formula | C12H14N2O7S |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | [(5S)-3-ethyl-2-oxo-1,3-oxazolidin-5-yl]methyl 4-nitrobenzenesulfonate |
| SMILES | CCN1C[C@@H](COS(=O)(=O)c2ccc([N+](=O)[O-])cc2)OC1=O |
| InChI | InChI=1S/C12H14N2O7S/c1-2-13-7-10(21-12(13)15)8-20-22(18,19)11-5-3-9(4-6-11)14(16)17/h3-6,10H,2,7-8H2,1H3/t10-/m0/s1 |
| InChIKey | HQMXOCKKGZAYDC-JTQLQIEISA-N |
| XLogP | 1.14 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|