C19H24N2O8S — CID 168934340
methyl (1R,5S)-5-[(2-methylpropan-2-yl)oxycarbonyl-(4-nitrophenyl)sulfonylamino]cyclohex-3-ene-1-carboxylate (PubChem CID 168934340) has the molecular formula C19H24N2O8S and a molecular weight of 440.47 g/mol. Its IUPAC name is methyl (1R,5S)-5-[(2-methylpropan-2-yl)oxycarbonyl-(4-nitrophenyl)sulfonylamino]cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,5S)-5-[(2-methylpropan-2-yl)oxycarbonyl-(4-nitrophenyl)sulfonylamino]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 168934340 |
| Molecular Formula | C19H24N2O8S |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | methyl (1R,5S)-5-[(2-methylpropan-2-yl)oxycarbonyl-(4-nitrophenyl)sulfonylamino]cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC=C[C@@H](N(C(=O)OC(C)(C)C)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C19H24N2O8S/c1-19(2,3)29-18(23)20(15-7-5-6-13(12-15)17(22)28-4)30(26,27)16-10-8-14(9-11-16)21(24)25/h5,7-11,13,15H,6,12H2,1-4H3/t13-,15-/m1/s1 |
| InChIKey | HIRAJDAOEQKRIG-UKRRQHHQSA-N |
| XLogP | 3.03 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|