C16H17NO6 — CID 3658740
methyl 2-acetyloxy-6-(4-nitrophenyl)cyclohex-3-ene-1-carboxylate (PubChem CID 3658740) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is methyl 2-acetyloxy-6-(4-nitrophenyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl 2-acetyloxy-6-(4-nitrophenyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 3658740 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | methyl 2-acetyloxy-6-(4-nitrophenyl)cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)C1C(OC(C)=O)C=CCC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H17NO6/c1-10(18)23-14-5-3-4-13(15(14)16(19)22-2)11-6-8-12(9-7-11)17(20)21/h3,5-9,13-15H,4H2,1-2H3 |
| InChIKey | SLBNRWJSUPMDFH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|