C14H18N2O4 — CID 71245294
[2-(4-nitrophenyl)cyclopropyl] N-tert-butylcarbamate (PubChem CID 71245294) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is [2-(4-nitrophenyl)cyclopropyl] N-tert-butylcarbamate.
| Compound Name | [2-(4-nitrophenyl)cyclopropyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 71245294 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [2-(4-nitrophenyl)cyclopropyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H18N2O4/c1-14(2,3)15-13(17)20-12-8-11(12)9-4-6-10(7-5-9)16(18)19/h4-7,11-12H,8H2,1-3H3,(H,15,17) |
| InChIKey | ARQKFTISWLVXHJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|