C11H15NO6 — CID 139417091
ethyl (1R)-5-acetyloxy-6-nitrocyclohex-3-ene-1-carboxylate (PubChem CID 139417091) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is ethyl (1R)-5-acetyloxy-6-nitrocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1R)-5-acetyloxy-6-nitrocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 139417091 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | ethyl (1R)-5-acetyloxy-6-nitrocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC=CC(OC(C)=O)C1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15NO6/c1-3-17-11(14)8-5-4-6-9(18-7(2)13)10(8)12(15)16/h4,6,8-10H,3,5H2,1-2H3/t8-,9?,10?/m1/s1 |
| InChIKey | JEYXDWBGAXACCZ-XNWIYYODSA-N |
| XLogP | 0.70 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|