(1S,5R,6R)-5,6-diacetyloxycyclohex-3-ene-1-carboxylic acid

C11H14O6 — CID 71355610

IUPAC(1S,5R,6R)-5,6-diacetyloxycyclohex-3-ene-1-carboxylic acid
SMILESCC(=O)O[C@@H]1[C@@H](C(=O)O)CC=C[C@H]1OC(C)=O
InChIInChI=1S/C11H14O6/c1-6(12)16-9-5-3-4-8(11(14)15)10(9)17-7(2)13/h3,5,8-10H,4H2,1-2H3,(H,14,15)/t8-,9+,10+/m0/s1
InChIKeyMFKFAXTWVYCOIO-IVZWLZJFSA-N
MW242.23 g/mol
LogP0.51
Rot. Bonds3

About (1S,5R,6R)-5,6-diacetyloxycyclohex-3-ene-1-carboxylic acid

(1S,5R,6R)-5,6-diacetyloxycyclohex-3-ene-1-carboxylic acid (PubChem CID 71355610) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is (1S,5R,6R)-5,6-diacetyloxycyclohex-3-ene-1-carboxylic acid.

Molecular Properties

Compound Name(1S,5R,6R)-5,6-diacetyloxycyclohex-3-ene-1-carboxylic acid
PubChem CID71355610
Molecular FormulaC11H14O6
Molecular Weight242.23 g/mol
Exact Mass242.08
IUPAC Name(1S,5R,6R)-5,6-diacetyloxycyclohex-3-ene-1-carboxylic acid
SMILESCC(=O)O[C@@H]1[C@@H](C(=O)O)CC=C[C@H]1OC(C)=O
InChIInChI=1S/C11H14O6/c1-6(12)16-9-5-3-4-8(11(14)15)10(9)17-7(2)13/h3,5,8-10H,4H2,1-2H3,(H,14,15)/t8-,9+,10+/m0/s1
InChIKeyMFKFAXTWVYCOIO-IVZWLZJFSA-N
XLogP0.51
TPSA89.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.23
LogP ≤ 50.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (1S,5R,6R)-5,6-diacetyloxycyclohex-3-ene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1S,5R,6R)-5,6-diacetyloxycyclohex-3-ene-1-carboxylic acid?
The IUPAC name of (1S,5R,6R)-5,6-diacetyloxycyclohex-3-ene-1-carboxylic acid (CID 71355610) is (1S,5R,6R)-5,6-diacetyloxycyclohex-3-ene-1-carboxylic acid.
What is the SMILES notation for (1S,5R,6R)-5,6-diacetyloxycyclohex-3-ene-1-carboxylic acid?
The canonical SMILES for (1S,5R,6R)-5,6-diacetyloxycyclohex-3-ene-1-carboxylic acid is CC(=O)O[C@@H]1[C@@H](C(=O)O)CC=C[C@H]1OC(C)=O.
What is the InChIKey of (1S,5R,6R)-5,6-diacetyloxycyclohex-3-ene-1-carboxylic acid?
The InChIKey is MFKFAXTWVYCOIO-IVZWLZJFSA-N. The full InChI is InChI=1S/C11H14O6/c1-6(12)16-9-5-3-4-8(11(14)15)10(9)17-7(2)13/h3,5,8-10H,4H2,1-2H3,(H,14,15)/t8-,9+,10+/m0/s1.
What are the key properties of (1S,5R,6R)-5,6-diacetyloxycyclohex-3-ene-1-carboxylic acid?
(1S,5R,6R)-5,6-diacetyloxycyclohex-3-ene-1-carboxylic acid has a molecular weight of 242.23 g/mol, XLogP of 0.51, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R,6R)-5,6-diacetyloxycyclohex-3-ene-1-carboxylic acid is sourced from PubChem (CID 71355610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).