C10H14O6 — CID 101203630
[(1R,4S,5R,6S)-6-acetyloxy-4,5-dihydroxycyclohex-2-en-1-yl] acetate (PubChem CID 101203630) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is [(1R,4S,5R,6S)-6-acetyloxy-4,5-dihydroxycyclohex-2-en-1-yl] acetate.
| Compound Name | [(1R,4S,5R,6S)-6-acetyloxy-4,5-dihydroxycyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 101203630 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | [(1R,4S,5R,6S)-6-acetyloxy-4,5-dihydroxycyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](O)[C@@H](O)C=C[C@H]1OC(C)=O |
| InChI | InChI=1S/C10H14O6/c1-5(11)15-8-4-3-7(13)9(14)10(8)16-6(2)12/h3-4,7-10,13-14H,1-2H3/t7-,8+,9+,10+/m0/s1 |
| InChIKey | QNIDVYWZVDMFEA-SGIHWFKDSA-N |
| XLogP | -0.86 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|