C12H16O5 — CID 25187131
[(3aS,4S,5R,7aR)-4-acetyloxy-1,3,3a,4,5,7a-hexahydro-2-benzofuran-5-yl] acetate (PubChem CID 25187131) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is [(3aS,4S,5R,7aR)-4-acetyloxy-1,3,3a,4,5,7a-hexahydro-2-benzofuran-5-yl] acetate.
| Compound Name | [(3aS,4S,5R,7aR)-4-acetyloxy-1,3,3a,4,5,7a-hexahydro-2-benzofuran-5-yl] acetate |
|---|---|
| PubChem CID | 25187131 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | [(3aS,4S,5R,7aR)-4-acetyloxy-1,3,3a,4,5,7a-hexahydro-2-benzofuran-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]2COC[C@@H]2C=C[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H16O5/c1-7(13)16-11-4-3-9-5-15-6-10(9)12(11)17-8(2)14/h3-4,9-12H,5-6H2,1-2H3/t9-,10+,11+,12-/m0/s1 |
| InChIKey | SCHYJNLFJYJPGY-QCNOEVLYSA-N |
| XLogP | 0.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|