C22H31BrN2O12 — CID 161419695
[(1E)-buta-1,3-dienyl] acetate;ethyl (1R,5R,6S)-5-acetyloxy-6-nitrocyclohex-3-ene-1-carboxylate;ethyl 2-bromo-3-nitropropanoate (PubChem CID 161419695) has the molecular formula C22H31BrN2O12 and a molecular weight of 595.40 g/mol. Its IUPAC name is [(1E)-buta-1,3-dienyl] acetate;ethyl (1R,5R,6S)-5-acetyloxy-6-nitrocyclohex-3-ene-1-carboxylate;ethyl 2-bromo-3-nitropropanoate.
| Compound Name | [(1E)-buta-1,3-dienyl] acetate;ethyl (1R,5R,6S)-5-acetyloxy-6-nitrocyclohex-3-ene-1-carboxylate;ethyl 2-bromo-3-nitropropanoate |
|---|---|
| PubChem CID | 161419695 |
| Molecular Formula | C22H31BrN2O12 |
| Molecular Weight | 595.40 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | [(1E)-buta-1,3-dienyl] acetate;ethyl (1R,5R,6S)-5-acetyloxy-6-nitrocyclohex-3-ene-1-carboxylate;ethyl 2-bromo-3-nitropropanoate |
| SMILES | C=C/C=C/OC(C)=O.CCOC(=O)C(Br)C[N+](=O)[O-].CCOC(=O)[C@@H]1CC=C[C@@H](OC(C)=O)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15NO6.C6H8O2.C5H8BrNO4/c1-3-17-11(14)8-5-4-6-9(18-7(2)13)10(8)12(15)16;1-3-4-5-8-6(2)7;1-2-11-5(8)4(6)3-7(9)10/h4,6,8-10H,3,5H2,1-2H3;3-5H,1H2,2H3;4H,2-3H2,1H3/b;5-4+;/t8-,9-,10+;;/m1../s1 |
| InChIKey | VWOHDEGJEADLHY-HXZMFDKZSA-N |
| XLogP | 2.54 |
| TPSA | 191.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|