C17H23NO5S — CID 10991820
tert-butyl N-(4-methylphenyl)sulfonyl-N-[(1R,5S)-6-oxabicyclo[3.1.0]hexan-3-yl]carbamate (PubChem CID 10991820) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is tert-butyl N-(4-methylphenyl)sulfonyl-N-[(1R,5S)-6-oxabicyclo[3.1.0]hexan-3-yl]carbamate.
| Compound Name | tert-butyl N-(4-methylphenyl)sulfonyl-N-[(1R,5S)-6-oxabicyclo[3.1.0]hexan-3-yl]carbamate |
|---|---|
| PubChem CID | 10991820 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | tert-butyl N-(4-methylphenyl)sulfonyl-N-[(1R,5S)-6-oxabicyclo[3.1.0]hexan-3-yl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)N(C(=O)OC(C)(C)C)C2C[C@@H]3O[C@@H]3C2)cc1 |
| InChI | InChI=1S/C17H23NO5S/c1-11-5-7-13(8-6-11)24(20,21)18(16(19)23-17(2,3)4)12-9-14-15(10-12)22-14/h5-8,12,14-15H,9-10H2,1-4H3/t12?,14-,15+ |
| InChIKey | AYKYSQXZNXFUJQ-LQDVMPOASA-N |
| XLogP | 2.85 |
| TPSA | 76.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|