C23H30N2O4S — CID 10765091
tert-butyl N-[(3-methylphenyl)methyl]-N-[[(2S)-1-(4-methylphenyl)sulfonylaziridin-2-yl]methyl]carbamate (PubChem CID 10765091) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is tert-butyl N-[(3-methylphenyl)methyl]-N-[[(2S)-1-(4-methylphenyl)sulfonylaziridin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[(3-methylphenyl)methyl]-N-[[(2S)-1-(4-methylphenyl)sulfonylaziridin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 10765091 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | tert-butyl N-[(3-methylphenyl)methyl]-N-[[(2S)-1-(4-methylphenyl)sulfonylaziridin-2-yl]methyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]2CN(Cc2cccc(C)c2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H30N2O4S/c1-17-9-11-21(12-10-17)30(27,28)25-16-20(25)15-24(22(26)29-23(3,4)5)14-19-8-6-7-18(2)13-19/h6-13,20H,14-16H2,1-5H3/t20-,25?/m0/s1 |
| InChIKey | HBPKJKCLJFSCKL-JINQPTGOSA-N |
| XLogP | 4.11 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|