C22H27NO7S — CID 91549519
3-[3-[[benzenesulfonyloxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]propanoic acid (PubChem CID 91549519) has the molecular formula C22H27NO7S and a molecular weight of 449.53 g/mol. Its IUPAC name is 3-[3-[[benzenesulfonyloxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]propanoic acid.
| Compound Name | 3-[3-[[benzenesulfonyloxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 91549519 |
| Molecular Formula | C22H27NO7S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 3-[3-[[benzenesulfonyloxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N(COS(=O)(=O)c1ccccc1)Cc1cccc(CCC(=O)O)c1 |
| InChI | InChI=1S/C22H27NO7S/c1-22(2,3)30-21(26)23(16-29-31(27,28)19-10-5-4-6-11-19)15-18-9-7-8-17(14-18)12-13-20(24)25/h4-11,14H,12-13,15-16H2,1-3H3,(H,24,25) |
| InChIKey | GGIVDJFPWUFEHE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|