C18H27BrN2O4S — CID 165180512
tert-butyl (2R,5S)-4-[4-(bromomethyl)phenyl]sulfonyl-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 165180512) has the molecular formula C18H27BrN2O4S and a molecular weight of 447.40 g/mol. Its IUPAC name is tert-butyl (2R,5S)-4-[4-(bromomethyl)phenyl]sulfonyl-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,5S)-4-[4-(bromomethyl)phenyl]sulfonyl-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 165180512 |
| Molecular Formula | C18H27BrN2O4S |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | tert-butyl (2R,5S)-4-[4-(bromomethyl)phenyl]sulfonyl-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2ccc(CBr)cc2)[C@@H](C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27BrN2O4S/c1-13-12-21(14(2)11-20(13)17(22)25-18(3,4)5)26(23,24)16-8-6-15(10-19)7-9-16/h6-9,13-14H,10-12H2,1-5H3/t13-,14+/m1/s1 |
| InChIKey | VXDQNLKMFBXILL-KGLIPLIRSA-N |
| XLogP | 3.60 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|