C27H29N3O9S2 — CID 53254212
tert-butyl N-[1-(furan-2-yl)-2-[(4-methylphenyl)sulfonyl-propa-1,2-dienylamino]ethyl]-N-(4-nitrophenyl)sulfonylcarbamate (PubChem CID 53254212) has the molecular formula C27H29N3O9S2 and a molecular weight of 603.68 g/mol. Its IUPAC name is tert-butyl N-[1-(furan-2-yl)-2-[(4-methylphenyl)sulfonyl-propa-1,2-dienylamino]ethyl]-N-(4-nitrophenyl)sulfonylcarbamate.
| Compound Name | tert-butyl N-[1-(furan-2-yl)-2-[(4-methylphenyl)sulfonyl-propa-1,2-dienylamino]ethyl]-N-(4-nitrophenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 53254212 |
| Molecular Formula | C27H29N3O9S2 |
| Molecular Weight | 603.68 g/mol |
| Exact Mass | 603.13 |
| IUPAC Name | tert-butyl N-[1-(furan-2-yl)-2-[(4-methylphenyl)sulfonyl-propa-1,2-dienylamino]ethyl]-N-(4-nitrophenyl)sulfonylcarbamate |
| SMILES | C=C=CN(CC(c1ccco1)N(C(=O)OC(C)(C)C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H29N3O9S2/c1-6-17-28(40(34,35)22-13-9-20(2)10-14-22)19-24(25-8-7-18-38-25)29(26(31)39-27(3,4)5)41(36,37)23-15-11-21(12-16-23)30(32)33/h7-18,24H,1,19H2,2-5H3 |
| InChIKey | ZBSDBUJKWULTPH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 157.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.68 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|