C13H15N3O8 — CID 121003968
(2S)-2-[N-[(2-methylpropan-2-yl)oxycarbonyl]-4-nitroanilino]-2-nitroacetic acid (PubChem CID 121003968) has the molecular formula C13H15N3O8 and a molecular weight of 341.28 g/mol. Its IUPAC name is (2S)-2-[N-[(2-methylpropan-2-yl)oxycarbonyl]-4-nitroanilino]-2-nitroacetic acid.
| Compound Name | (2S)-2-[N-[(2-methylpropan-2-yl)oxycarbonyl]-4-nitroanilino]-2-nitroacetic acid |
|---|---|
| PubChem CID | 121003968 |
| Molecular Formula | C13H15N3O8 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (2S)-2-[N-[(2-methylpropan-2-yl)oxycarbonyl]-4-nitroanilino]-2-nitroacetic acid |
| SMILES | CC(C)(C)OC(=O)N(c1ccc([N+](=O)[O-])cc1)[C@H](C(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N3O8/c1-13(2,3)24-12(19)14(10(11(17)18)16(22)23)8-4-6-9(7-5-8)15(20)21/h4-7,10H,1-3H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | SKJBLDZRYDROAE-JTQLQIEISA-N |
| XLogP | 2.02 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|