C18H23N3O11 — CID 88704855
(2S)-2-amino-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl-[2-[(4-nitrophenyl)methoxy]-2-oxoethoxy]amino]-4-oxobutanoic acid (PubChem CID 88704855) has the molecular formula C18H23N3O11 and a molecular weight of 457.39 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl-[2-[(4-nitrophenyl)methoxy]-2-oxoethoxy]amino]-4-oxobutanoic acid.
| Compound Name | (2S)-2-amino-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl-[2-[(4-nitrophenyl)methoxy]-2-oxoethoxy]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 88704855 |
| Molecular Formula | C18H23N3O11 |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | (2S)-2-amino-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl-[2-[(4-nitrophenyl)methoxy]-2-oxoethoxy]amino]-4-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)N(OCC(=O)OCc1ccc([N+](=O)[O-])cc1)C(=O)C(O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C18H23N3O11/c1-18(2,3)32-17(27)20(15(24)14(23)13(19)16(25)26)31-9-12(22)30-8-10-4-6-11(7-5-10)21(28)29/h4-7,13-14,23H,8-9,19H2,1-3H3,(H,25,26)/t13-,14?/m0/s1 |
| InChIKey | KJOIOQBEIVVWMG-LSLKUGRBSA-N |
| XLogP | 0.11 |
| TPSA | 208.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|