C24H35NO8 — CID 70069192
1-O,1-O-ditert-butyl 2-O-[(4-nitrophenyl)methyl] (2R)-4-methylpentane-1,1,2-tricarboxylate (PubChem CID 70069192) has the molecular formula C24H35NO8 and a molecular weight of 465.54 g/mol. Its IUPAC name is 1-O,1-O-ditert-butyl 2-O-[(4-nitrophenyl)methyl] (2R)-4-methylpentane-1,1,2-tricarboxylate.
| Compound Name | 1-O,1-O-ditert-butyl 2-O-[(4-nitrophenyl)methyl] (2R)-4-methylpentane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 70069192 |
| Molecular Formula | C24H35NO8 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 1-O,1-O-ditert-butyl 2-O-[(4-nitrophenyl)methyl] (2R)-4-methylpentane-1,1,2-tricarboxylate |
| SMILES | CC(C)C[C@@H](C(=O)OCc1ccc([N+](=O)[O-])cc1)C(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H35NO8/c1-15(2)13-18(20(26)31-14-16-9-11-17(12-10-16)25(29)30)19(21(27)32-23(3,4)5)22(28)33-24(6,7)8/h9-12,15,18-19H,13-14H2,1-8H3/t18-/m1/s1 |
| InChIKey | MVVLSHNPLODMKP-GOSISDBHSA-N |
| XLogP | 4.60 |
| TPSA | 122.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|