C21H30N2O6 — CID 98651848
diethyl (1S,2R,3R,4R,6E)-2-[4-(dimethylamino)phenyl]-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate (PubChem CID 98651848) has the molecular formula C21H30N2O6 and a molecular weight of 406.48 g/mol. Its IUPAC name is diethyl (1S,2R,3R,4R,6E)-2-[4-(dimethylamino)phenyl]-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate.
| Compound Name | diethyl (1S,2R,3R,4R,6E)-2-[4-(dimethylamino)phenyl]-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 98651848 |
| Molecular Formula | C21H30N2O6 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | diethyl (1S,2R,3R,4R,6E)-2-[4-(dimethylamino)phenyl]-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1/C(=N/O)C[C@@](C)(O)[C@H](C(=O)OCC)[C@@H]1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H30N2O6/c1-6-28-19(24)17-15(22-27)12-21(3,26)18(20(25)29-7-2)16(17)13-8-10-14(11-9-13)23(4)5/h8-11,16-18,26-27H,6-7,12H2,1-5H3/b22-15+/t16-,17-,18+,21-/m1/s1 |
| InChIKey | DGWIJMWFTDFEFR-SDAKVJOXSA-N |
| XLogP | 2.18 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|