C27H31FO9 — CID 51506334
bis(2-methoxyethyl) (1S,2R,3S,4R)-2-(4-fluoro-3-phenoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate (PubChem CID 51506334) has the molecular formula C27H31FO9 and a molecular weight of 518.53 g/mol. Its IUPAC name is bis(2-methoxyethyl) (1S,2R,3S,4R)-2-(4-fluoro-3-phenoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate.
| Compound Name | bis(2-methoxyethyl) (1S,2R,3S,4R)-2-(4-fluoro-3-phenoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 51506334 |
| Molecular Formula | C27H31FO9 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | bis(2-methoxyethyl) (1S,2R,3S,4R)-2-(4-fluoro-3-phenoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
| SMILES | COCCOC(=O)[C@@H]1C(=O)C[C@@](C)(O)[C@@H](C(=O)OCCOC)[C@H]1c1ccc(F)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C27H31FO9/c1-27(32)16-20(29)23(25(30)35-13-11-33-2)22(24(27)26(31)36-14-12-34-3)17-9-10-19(28)21(15-17)37-18-7-5-4-6-8-18/h4-10,15,22-24,32H,11-14,16H2,1-3H3/t22-,23+,24+,27+/m0/s1 |
| InChIKey | CFVOTOSUBYRPIK-ZOJNDGCKSA-N |
| XLogP | 3.04 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|