C20H24N2O7 — CID 71470887
8-O-ethyl 6-O-methyl 5,8a-dimethyl-7-(3-nitrophenyl)-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-6,8-dicarboxylate (PubChem CID 71470887) has the molecular formula C20H24N2O7 and a molecular weight of 404.42 g/mol. Its IUPAC name is 8-O-ethyl 6-O-methyl 5,8a-dimethyl-7-(3-nitrophenyl)-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-6,8-dicarboxylate.
| Compound Name | 8-O-ethyl 6-O-methyl 5,8a-dimethyl-7-(3-nitrophenyl)-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-6,8-dicarboxylate |
|---|---|
| PubChem CID | 71470887 |
| Molecular Formula | C20H24N2O7 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 8-O-ethyl 6-O-methyl 5,8a-dimethyl-7-(3-nitrophenyl)-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-6,8-dicarboxylate |
| SMILES | CCOC(=O)C1C(c2cccc([N+](=O)[O-])c2)C(C(=O)OC)=C(C)N2CCOC12C |
| InChI | InChI=1S/C20H24N2O7/c1-5-28-19(24)17-16(13-7-6-8-14(11-13)22(25)26)15(18(23)27-4)12(2)21-9-10-29-20(17,21)3/h6-8,11,16-17H,5,9-10H2,1-4H3 |
| InChIKey | DALCWFLHLPLCKX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|