C26H21ClN2O6 — CID 101094622
methyl (2'S,3S,3'S,5'S)-5'-(4-chlorophenyl)-3'-(4-nitrophenyl)-4-oxospiro[2H-chromene-3,4'-pyrrolidine]-2'-carboxylate (PubChem CID 101094622) has the molecular formula C26H21ClN2O6 and a molecular weight of 492.92 g/mol. Its IUPAC name is methyl (2'S,3S,3'S,5'S)-5'-(4-chlorophenyl)-3'-(4-nitrophenyl)-4-oxospiro[2H-chromene-3,4'-pyrrolidine]-2'-carboxylate.
| Compound Name | methyl (2'S,3S,3'S,5'S)-5'-(4-chlorophenyl)-3'-(4-nitrophenyl)-4-oxospiro[2H-chromene-3,4'-pyrrolidine]-2'-carboxylate |
|---|---|
| PubChem CID | 101094622 |
| Molecular Formula | C26H21ClN2O6 |
| Molecular Weight | 492.92 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | methyl (2'S,3S,3'S,5'S)-5'-(4-chlorophenyl)-3'-(4-nitrophenyl)-4-oxospiro[2H-chromene-3,4'-pyrrolidine]-2'-carboxylate |
| SMILES | COC(=O)[C@H]1N[C@@H](c2ccc(Cl)cc2)[C@]2(COc3ccccc3C2=O)[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H21ClN2O6/c1-34-25(31)22-21(15-8-12-18(13-9-15)29(32)33)26(23(28-22)16-6-10-17(27)11-7-16)14-35-20-5-3-2-4-19(20)24(26)30/h2-13,21-23,28H,14H2,1H3/t21-,22+,23+,26+/m1/s1 |
| InChIKey | FCSQXXKYYBNKRL-KSZLKVKMSA-N |
| XLogP | 4.48 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.92 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|