C19H13ClN2O6 — CID 98771985
methyl (1R,5S,6S)-1-(4-chlorophenyl)-3-(4-nitrophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 98771985) has the molecular formula C19H13ClN2O6 and a molecular weight of 400.77 g/mol. Its IUPAC name is methyl (1R,5S,6S)-1-(4-chlorophenyl)-3-(4-nitrophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | methyl (1R,5S,6S)-1-(4-chlorophenyl)-3-(4-nitrophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 98771985 |
| Molecular Formula | C19H13ClN2O6 |
| Molecular Weight | 400.77 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | methyl (1R,5S,6S)-1-(4-chlorophenyl)-3-(4-nitrophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H]2C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)[C@@]12c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H13ClN2O6/c1-28-17(24)15-14-16(23)21(12-6-8-13(9-7-12)22(26)27)18(25)19(14,15)10-2-4-11(20)5-3-10/h2-9,14-15H,1H3/t14-,15-,19-/m1/s1 |
| InChIKey | ONOCEVUARQLKJH-SPYBWZPUSA-N |
| XLogP | 2.48 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.77 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|