C14H12N4O6 — CID 3112900
methyl 6a-methyl-5-(4-nitrophenyl)-4,6-dioxo-1,3a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 3112900) has the molecular formula C14H12N4O6 and a molecular weight of 332.27 g/mol. Its IUPAC name is methyl 6a-methyl-5-(4-nitrophenyl)-4,6-dioxo-1,3a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | methyl 6a-methyl-5-(4-nitrophenyl)-4,6-dioxo-1,3a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 3112900 |
| Molecular Formula | C14H12N4O6 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | methyl 6a-methyl-5-(4-nitrophenyl)-4,6-dioxo-1,3a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | COC(=O)C1=NNC2(C)C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)C12 |
| InChI | InChI=1S/C14H12N4O6/c1-14-9(10(15-16-14)12(20)24-2)11(19)17(13(14)21)7-3-5-8(6-4-7)18(22)23/h3-6,9,16H,1-2H3 |
| InChIKey | SSSSKXJNQLYSNI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|