C19H14N4O6 — CID 3964675
methyl 6a-(3-nitrophenyl)-4,6-dioxo-5-phenyl-1,3a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 3964675) has the molecular formula C19H14N4O6 and a molecular weight of 394.34 g/mol. Its IUPAC name is methyl 6a-(3-nitrophenyl)-4,6-dioxo-5-phenyl-1,3a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | methyl 6a-(3-nitrophenyl)-4,6-dioxo-5-phenyl-1,3a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 3964675 |
| Molecular Formula | C19H14N4O6 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | methyl 6a-(3-nitrophenyl)-4,6-dioxo-5-phenyl-1,3a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | COC(=O)C1=NNC2(c3cccc([N+](=O)[O-])c3)C(=O)N(c3ccccc3)C(=O)C12 |
| InChI | InChI=1S/C19H14N4O6/c1-29-17(25)15-14-16(24)22(12-7-3-2-4-8-12)18(26)19(14,21-20-15)11-6-5-9-13(10-11)23(27)28/h2-10,14,21H,1H3 |
| InChIKey | IHDJIERXLABMQW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|