C15H14N4O6 — CID 7386300
ethyl (3aS,6aR)-6a-methyl-5-(4-nitrophenyl)-4,6-dioxo-1,3a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 7386300) has the molecular formula C15H14N4O6 and a molecular weight of 346.30 g/mol. Its IUPAC name is ethyl (3aS,6aR)-6a-methyl-5-(4-nitrophenyl)-4,6-dioxo-1,3a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | ethyl (3aS,6aR)-6a-methyl-5-(4-nitrophenyl)-4,6-dioxo-1,3a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 7386300 |
| Molecular Formula | C15H14N4O6 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | ethyl (3aS,6aR)-6a-methyl-5-(4-nitrophenyl)-4,6-dioxo-1,3a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NN[C@@]2(C)C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C15H14N4O6/c1-3-25-13(21)11-10-12(20)18(14(22)15(10,2)17-16-11)8-4-6-9(7-5-8)19(23)24/h4-7,10,17H,3H2,1-2H3/t10-,15+/m0/s1 |
| InChIKey | RQLCLNJODMMSBW-ZUZCIYMTSA-N |
| XLogP | 0.37 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|