C20H16N4O6 — CID 2857186
ethyl 6a-(3-nitrophenyl)-4,6-dioxo-5-phenyl-1,3a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 2857186) has the molecular formula C20H16N4O6 and a molecular weight of 408.37 g/mol. Its IUPAC name is ethyl 6a-(3-nitrophenyl)-4,6-dioxo-5-phenyl-1,3a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | ethyl 6a-(3-nitrophenyl)-4,6-dioxo-5-phenyl-1,3a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 2857186 |
| Molecular Formula | C20H16N4O6 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | ethyl 6a-(3-nitrophenyl)-4,6-dioxo-5-phenyl-1,3a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NNC2(c3cccc([N+](=O)[O-])c3)C(=O)N(c3ccccc3)C(=O)C12 |
| InChI | InChI=1S/C20H16N4O6/c1-2-30-18(26)16-15-17(25)23(13-8-4-3-5-9-13)19(27)20(15,22-21-16)12-7-6-10-14(11-12)24(28)29/h3-11,15,22H,2H2,1H3 |
| InChIKey | LUFWWQPZKNTNBC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|