C13H8N4O6 — CID 11381504
methyl 5-(4-nitrophenyl)-4,6-dioxo-2H-pyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 11381504) has the molecular formula C13H8N4O6 and a molecular weight of 316.23 g/mol. Its IUPAC name is methyl 5-(4-nitrophenyl)-4,6-dioxo-2H-pyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | methyl 5-(4-nitrophenyl)-4,6-dioxo-2H-pyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 11381504 |
| Molecular Formula | C13H8N4O6 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | methyl 5-(4-nitrophenyl)-4,6-dioxo-2H-pyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | COC(=O)c1[nH]nc2c1C(=O)N(c1ccc([N+](=O)[O-])cc1)C2=O |
| InChI | InChI=1S/C13H8N4O6/c1-23-13(20)10-8-9(14-15-10)12(19)16(11(8)18)6-2-4-7(5-3-6)17(21)22/h2-5H,1H3,(H,14,15) |
| InChIKey | FPQHFQYRKNIFSC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 135.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|