C15H12BrN3O5 — CID 5350194
ethyl 5-(3-bromo-4-methoxyphenyl)-4,6-dioxo-2H-pyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 5350194) has the molecular formula C15H12BrN3O5 and a molecular weight of 394.18 g/mol. Its IUPAC name is ethyl 5-(3-bromo-4-methoxyphenyl)-4,6-dioxo-2H-pyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | ethyl 5-(3-bromo-4-methoxyphenyl)-4,6-dioxo-2H-pyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 5350194 |
| Molecular Formula | C15H12BrN3O5 |
| Molecular Weight | 394.18 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | ethyl 5-(3-bromo-4-methoxyphenyl)-4,6-dioxo-2H-pyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1[nH]nc2c1C(=O)N(c1ccc(OC)c(Br)c1)C2=O |
| InChI | InChI=1S/C15H12BrN3O5/c1-3-24-15(22)12-10-11(17-18-12)14(21)19(13(10)20)7-4-5-9(23-2)8(16)6-7/h4-6H,3H2,1-2H3,(H,17,18) |
| InChIKey | HKVRQPGXGPSEEJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|