C15H13N3O5 — CID 46887761
ethyl 5-(2-methoxyphenyl)-4,6-dioxo-2H-pyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 46887761) has the molecular formula C15H13N3O5 and a molecular weight of 315.29 g/mol. Its IUPAC name is ethyl 5-(2-methoxyphenyl)-4,6-dioxo-2H-pyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | ethyl 5-(2-methoxyphenyl)-4,6-dioxo-2H-pyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46887761 |
| Molecular Formula | C15H13N3O5 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | ethyl 5-(2-methoxyphenyl)-4,6-dioxo-2H-pyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1[nH]nc2c1C(=O)N(c1ccccc1OC)C2=O |
| InChI | InChI=1S/C15H13N3O5/c1-3-23-15(21)12-10-11(16-17-12)14(20)18(13(10)19)8-6-4-5-7-9(8)22-2/h4-7H,3H2,1-2H3,(H,16,17) |
| InChIKey | HQWJJAVSSGLIKR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|