C13H16FNO2 — CID 86767337
tert-butyl (2R,3R)-3-(3-fluorophenyl)aziridine-2-carboxylate (PubChem CID 86767337) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-(3-fluorophenyl)aziridine-2-carboxylate.
| Compound Name | tert-butyl (2R,3R)-3-(3-fluorophenyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 86767337 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | tert-butyl (2R,3R)-3-(3-fluorophenyl)aziridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1N[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C13H16FNO2/c1-13(2,3)17-12(16)11-10(15-11)8-5-4-6-9(14)7-8/h4-7,10-11,15H,1-3H3/t10-,11-/m1/s1 |
| InChIKey | FOATVYJZLYYGOO-GHMZBOCLSA-N |
| XLogP | 2.18 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|