C26H38N2O6 — CID 140858557
tert-butyl (2S,3R,4S,5S)-1-(cyclohexanecarbonyl)-3-(2-methoxypropan-2-yl)-4-nitro-5-phenylpyrrolidine-2-carboxylate (PubChem CID 140858557) has the molecular formula C26H38N2O6 and a molecular weight of 474.60 g/mol. Its IUPAC name is tert-butyl (2S,3R,4S,5S)-1-(cyclohexanecarbonyl)-3-(2-methoxypropan-2-yl)-4-nitro-5-phenylpyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S,3R,4S,5S)-1-(cyclohexanecarbonyl)-3-(2-methoxypropan-2-yl)-4-nitro-5-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 140858557 |
| Molecular Formula | C26H38N2O6 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | tert-butyl (2S,3R,4S,5S)-1-(cyclohexanecarbonyl)-3-(2-methoxypropan-2-yl)-4-nitro-5-phenylpyrrolidine-2-carboxylate |
| SMILES | COC(C)(C)[C@H]1[C@H]([N+](=O)[O-])[C@H](c2ccccc2)N(C(=O)C2CCCCC2)[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H38N2O6/c1-25(2,3)34-24(30)22-19(26(4,5)33-6)21(28(31)32)20(17-13-9-7-10-14-17)27(22)23(29)18-15-11-8-12-16-18/h7,9-10,13-14,18-22H,8,11-12,15-16H2,1-6H3/t19-,20-,21-,22-/m0/s1 |
| InChIKey | TVGVZMIBDFVNSE-CMOCDZPBSA-N |
| XLogP | 4.55 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|