C24H35N3O5 — CID 140858312
ethyl (2S,3R,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-5-(2-methyl-3-pyridinyl)-4-nitropyrrolidine-2-carboxylate (PubChem CID 140858312) has the molecular formula C24H35N3O5 and a molecular weight of 445.56 g/mol. Its IUPAC name is ethyl (2S,3R,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-5-(2-methyl-3-pyridinyl)-4-nitropyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,3R,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-5-(2-methyl-3-pyridinyl)-4-nitropyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 140858312 |
| Molecular Formula | C24H35N3O5 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | ethyl (2S,3R,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-5-(2-methyl-3-pyridinyl)-4-nitropyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C(C)(C)C)[C@H]([N+](=O)[O-])[C@H](c2cccnc2C)N1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C24H35N3O5/c1-6-32-23(29)21-18(24(3,4)5)20(27(30)31)19(17-13-10-14-25-15(17)2)26(21)22(28)16-11-8-7-9-12-16/h10,13-14,16,18-21H,6-9,11-12H2,1-5H3/t18-,19-,20-,21-/m0/s1 |
| InChIKey | BISWTGDAWDHZJZ-TUFLPTIASA-N |
| XLogP | 4.09 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|