C28H36N4O6 — CID 140858263
ethyl (2S,3R,4S,5S)-3-tert-butyl-1-(3,4-dihydro-2H-chromene-2-carbonyl)-5-[2-(dimethylamino)-3-pyridinyl]-4-nitropyrrolidine-2-carboxylate (PubChem CID 140858263) has the molecular formula C28H36N4O6 and a molecular weight of 524.62 g/mol. Its IUPAC name is ethyl (2S,3R,4S,5S)-3-tert-butyl-1-(3,4-dihydro-2H-chromene-2-carbonyl)-5-[2-(dimethylamino)-3-pyridinyl]-4-nitropyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,3R,4S,5S)-3-tert-butyl-1-(3,4-dihydro-2H-chromene-2-carbonyl)-5-[2-(dimethylamino)-3-pyridinyl]-4-nitropyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 140858263 |
| Molecular Formula | C28H36N4O6 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | ethyl (2S,3R,4S,5S)-3-tert-butyl-1-(3,4-dihydro-2H-chromene-2-carbonyl)-5-[2-(dimethylamino)-3-pyridinyl]-4-nitropyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C(C)(C)C)[C@H]([N+](=O)[O-])[C@H](c2cccnc2N(C)C)N1C(=O)C1CCc2ccccc2O1 |
| InChI | InChI=1S/C28H36N4O6/c1-7-37-27(34)24-21(28(2,3)4)23(32(35)36)22(18-12-10-16-29-25(18)30(5)6)31(24)26(33)20-15-14-17-11-8-9-13-19(17)38-20/h8-13,16,20-24H,7,14-15H2,1-6H3/t20?,21-,22-,23-,24-/m0/s1 |
| InChIKey | WUUSABXVINGEEE-RJBWIWMOSA-N |
| XLogP | 3.66 |
| TPSA | 115.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|