C26H36N2O6 — CID 140859281
ethyl (2S,3R,4S,5S)-3-tert-butyl-5-(2-cyclopropylphenyl)-4-nitro-1-[(2S)-oxane-2-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 140859281) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is ethyl (2S,3R,4S,5S)-3-tert-butyl-5-(2-cyclopropylphenyl)-4-nitro-1-[(2S)-oxane-2-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,3R,4S,5S)-3-tert-butyl-5-(2-cyclopropylphenyl)-4-nitro-1-[(2S)-oxane-2-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 140859281 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | ethyl (2S,3R,4S,5S)-3-tert-butyl-5-(2-cyclopropylphenyl)-4-nitro-1-[(2S)-oxane-2-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C(C)(C)C)[C@H]([N+](=O)[O-])[C@H](c2ccccc2C2CC2)N1C(=O)[C@@H]1CCCCO1 |
| InChI | InChI=1S/C26H36N2O6/c1-5-33-25(30)23-20(26(2,3)4)22(28(31)32)21(18-11-7-6-10-17(18)16-13-14-16)27(23)24(29)19-12-8-9-15-34-19/h6-7,10-11,16,19-23H,5,8-9,12-15H2,1-4H3/t19-,20-,21-,22-,23-/m0/s1 |
| InChIKey | XNHNFOULWZKUNI-VUBDRERZSA-N |
| XLogP | 4.26 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|