C24H35NO4 — CID 154016159
ethyl 3-tert-butyl-1-(cyclohexanecarbonyl)-4-hydroxy-5-phenylpyrrolidine-2-carboxylate (PubChem CID 154016159) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is ethyl 3-tert-butyl-1-(cyclohexanecarbonyl)-4-hydroxy-5-phenylpyrrolidine-2-carboxylate.
| Compound Name | ethyl 3-tert-butyl-1-(cyclohexanecarbonyl)-4-hydroxy-5-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 154016159 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | ethyl 3-tert-butyl-1-(cyclohexanecarbonyl)-4-hydroxy-5-phenylpyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1C(C(C)(C)C)C(O)C(c2ccccc2)N1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C24H35NO4/c1-5-29-23(28)20-18(24(2,3)4)21(26)19(16-12-8-6-9-13-16)25(20)22(27)17-14-10-7-11-15-17/h6,8-9,12-13,17-21,26H,5,7,10-11,14-15H2,1-4H3 |
| InChIKey | PYZPBKBLRIRGOF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |