C22H30N2O6 — CID 140857357
1-O-cyclobutyl 2-O-ethyl (2R,3S,4R,5R)-3-tert-butyl-4-nitro-5-phenylpyrrolidine-1,2-dicarboxylate (PubChem CID 140857357) has the molecular formula C22H30N2O6 and a molecular weight of 418.49 g/mol. Its IUPAC name is 1-O-cyclobutyl 2-O-ethyl (2R,3S,4R,5R)-3-tert-butyl-4-nitro-5-phenylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-cyclobutyl 2-O-ethyl (2R,3S,4R,5R)-3-tert-butyl-4-nitro-5-phenylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 140857357 |
| Molecular Formula | C22H30N2O6 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 1-O-cyclobutyl 2-O-ethyl (2R,3S,4R,5R)-3-tert-butyl-4-nitro-5-phenylpyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](C(C)(C)C)[C@@H]([N+](=O)[O-])[C@@H](c2ccccc2)N1C(=O)OC1CCC1 |
| InChI | InChI=1S/C22H30N2O6/c1-5-29-20(25)19-16(22(2,3)4)18(24(27)28)17(14-10-7-6-8-11-14)23(19)21(26)30-15-12-9-13-15/h6-8,10-11,15-19H,5,9,12-13H2,1-4H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | SMSOROFLAKXRMV-NCXUSEDFSA-N |
| XLogP | 3.97 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|