C31H42N2O3 — CID 140859108
(2S,3S,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-4-[(3,4-dimethylphenyl)methylamino]-5-phenylpyrrolidine-2-carboxylic acid (PubChem CID 140859108) has the molecular formula C31H42N2O3 and a molecular weight of 490.69 g/mol. Its IUPAC name is (2S,3S,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-4-[(3,4-dimethylphenyl)methylamino]-5-phenylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-4-[(3,4-dimethylphenyl)methylamino]-5-phenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 140859108 |
| Molecular Formula | C31H42N2O3 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | (2S,3S,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-4-[(3,4-dimethylphenyl)methylamino]-5-phenylpyrrolidine-2-carboxylic acid |
| SMILES | Cc1ccc(CN[C@H]2[C@H](C(C)(C)C)[C@@H](C(=O)O)N(C(=O)C3CCCCC3)[C@H]2c2ccccc2)cc1C |
| InChI | InChI=1S/C31H42N2O3/c1-20-16-17-22(18-21(20)2)19-32-26-25(31(3,4)5)28(30(35)36)33(27(26)23-12-8-6-9-13-23)29(34)24-14-10-7-11-15-24/h6,8-9,12-13,16-18,24-28,32H,7,10-11,14-15,19H2,1-5H3,(H,35,36)/t25-,26-,27-,28-/m0/s1 |
| InChIKey | GTXBPEQMBCECKT-LJWNLINESA-N |
| XLogP | 6.04 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |