C20H30N2O5 — CID 140857519
ethyl (2S,3R,4S,5S)-3-(2-methoxypropan-2-yl)-4-nitro-5-(2-propan-2-ylphenyl)pyrrolidine-2-carboxylate (PubChem CID 140857519) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is ethyl (2S,3R,4S,5S)-3-(2-methoxypropan-2-yl)-4-nitro-5-(2-propan-2-ylphenyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,3R,4S,5S)-3-(2-methoxypropan-2-yl)-4-nitro-5-(2-propan-2-ylphenyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 140857519 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | ethyl (2S,3R,4S,5S)-3-(2-methoxypropan-2-yl)-4-nitro-5-(2-propan-2-ylphenyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1N[C@@H](c2ccccc2C(C)C)[C@@H]([N+](=O)[O-])[C@@H]1C(C)(C)OC |
| InChI | InChI=1S/C20H30N2O5/c1-7-27-19(23)17-15(20(4,5)26-6)18(22(24)25)16(21-17)14-11-9-8-10-13(14)12(2)3/h8-12,15-18,21H,7H2,1-6H3/t15-,16+,17+,18+/m1/s1 |
| InChIKey | NAFNFZYDNHDCJP-OWSLCNJRSA-N |
| XLogP | 3.07 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|