C18H23NO4 — CID 171489343
tert-butyl N-[5-(2-methoxyphenyl)-3-oxocyclohexen-1-yl]carbamate (PubChem CID 171489343) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is tert-butyl N-[5-(2-methoxyphenyl)-3-oxocyclohexen-1-yl]carbamate.
| Compound Name | tert-butyl N-[5-(2-methoxyphenyl)-3-oxocyclohexen-1-yl]carbamate |
|---|---|
| PubChem CID | 171489343 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | tert-butyl N-[5-(2-methoxyphenyl)-3-oxocyclohexen-1-yl]carbamate |
| SMILES | COc1ccccc1C1CC(=O)C=C(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H23NO4/c1-18(2,3)23-17(21)19-13-9-12(10-14(20)11-13)15-7-5-6-8-16(15)22-4/h5-8,11-12H,9-10H2,1-4H3,(H,19,21) |
| InChIKey | JECATONSBXWBGR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |