C23H23N3O6 — CID 132543777
methyl (2R,3R,4S,5S)-5-(3-methoxyphenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)-3-phenylpyrrolidine-2-carboxylate (PubChem CID 132543777) has the molecular formula C23H23N3O6 and a molecular weight of 437.45 g/mol. Its IUPAC name is methyl (2R,3R,4S,5S)-5-(3-methoxyphenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)-3-phenylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2R,3R,4S,5S)-5-(3-methoxyphenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)-3-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 132543777 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | methyl (2R,3R,4S,5S)-5-(3-methoxyphenyl)-4-(3-methyl-4-nitro-1,2-oxazol-5-yl)-3-phenylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1N[C@H](c2cccc(OC)c2)[C@@H](c2onc(C)c2[N+](=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H23N3O6/c1-13-21(26(28)29)22(32-25-13)18-17(14-8-5-4-6-9-14)20(23(27)31-3)24-19(18)15-10-7-11-16(12-15)30-2/h4-12,17-20,24H,1-3H3/t17-,18-,19+,20+/m0/s1 |
| InChIKey | SIXVPXFVUXRPPT-VNTMZGSJSA-N |
| XLogP | 3.65 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|