C12H12ClNO4 — CID 24976381
methyl 3-(4-chlorophenyl)-2-oxo-1,3-oxazinane-4-carboxylate (PubChem CID 24976381) has the molecular formula C12H12ClNO4 and a molecular weight of 269.68 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-2-oxo-1,3-oxazinane-4-carboxylate.
| Compound Name | methyl 3-(4-chlorophenyl)-2-oxo-1,3-oxazinane-4-carboxylate |
|---|---|
| PubChem CID | 24976381 |
| Molecular Formula | C12H12ClNO4 |
| Molecular Weight | 269.68 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-2-oxo-1,3-oxazinane-4-carboxylate |
| SMILES | COC(=O)C1CCOC(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H12ClNO4/c1-17-11(15)10-6-7-18-12(16)14(10)9-4-2-8(13)3-5-9/h2-5,10H,6-7H2,1H3 |
| InChIKey | OLDAEFUKTAEFGF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.68 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |