C12H12ClNO3 — CID 42261094
methyl (2R)-1-(4-chlorophenyl)-5-oxopyrrolidine-2-carboxylate (PubChem CID 42261094) has the molecular formula C12H12ClNO3 and a molecular weight of 253.69 g/mol. Its IUPAC name is methyl (2R)-1-(4-chlorophenyl)-5-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl (2R)-1-(4-chlorophenyl)-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 42261094 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | methyl (2R)-1-(4-chlorophenyl)-5-oxopyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCC(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H12ClNO3/c1-17-12(16)10-6-7-11(15)14(10)9-4-2-8(13)3-5-9/h2-5,10H,6-7H2,1H3/t10-/m1/s1 |
| InChIKey | RCWHIQNBBHVUQB-SNVBAGLBSA-N |
| XLogP | 2.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |