C18H21ClN2O4 — CID 9391181
methyl 1-[(3S)-1-(4-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]piperidine-4-carboxylate (PubChem CID 9391181) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is methyl 1-[(3S)-1-(4-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(3S)-1-(4-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 9391181 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | methyl 1-[(3S)-1-(4-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)[C@H]2CC(=O)N(c3ccc(Cl)cc3)C2)CC1 |
| InChI | InChI=1S/C18H21ClN2O4/c1-25-18(24)12-6-8-20(9-7-12)17(23)13-10-16(22)21(11-13)15-4-2-14(19)3-5-15/h2-5,12-13H,6-11H2,1H3/t13-/m0/s1 |
| InChIKey | MBHLTIQSJKBKBL-ZDUSSCGKSA-N |
| XLogP | 2.10 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |