C17H22ClN3O2 — CID 119563793
1-(4-chlorophenyl)-4-[4-(methylamino)piperidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 119563793) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-[4-(methylamino)piperidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(4-chlorophenyl)-4-[4-(methylamino)piperidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 119563793 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1-(4-chlorophenyl)-4-[4-(methylamino)piperidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | CNC1CCN(C(=O)C2CC(=O)N(c3ccc(Cl)cc3)C2)CC1 |
| InChI | InChI=1S/C17H22ClN3O2/c1-19-14-6-8-20(9-7-14)17(23)12-10-16(22)21(11-12)15-4-2-13(18)3-5-15/h2-5,12,14,19H,6-11H2,1H3 |
| InChIKey | JRKXJMLOWIVIEG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |